C18H24N4O3S — CID 112935276
4-N-(1,1-dioxothiolan-3-yl)-2-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112935276) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-2-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112935276 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | COCCCNc1nc(NC2CCS(=O)(=O)C2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H24N4O3S/c1-25-10-5-9-19-18-21-16(14-6-3-2-4-7-14)12-17(22-18)20-15-8-11-26(23,24)13-15/h2-4,6-7,12,15H,5,8-11,13H2,1H3,(H2,19,20,21,22) |
| InChIKey | QPMFINDOLRBAIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|