C17H20N4O2S — CID 112933282
2-N-(1,1-dioxothiolan-3-yl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933282) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933282 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(-c2ccccc2)nc(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-2-9-18-16-11-15(13-6-4-3-5-7-13)20-17(21-16)19-14-8-10-24(22,23)12-14/h2-7,11,14H,1,8-10,12H2,(H2,18,19,20,21) |
| InChIKey | VSJLOXHJIOCRKJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|