C18H22N4O2S — CID 112933432
4-N-(1,1-dioxothiolan-3-yl)-4-N-methyl-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933432) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-4-N-methyl-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-methyl-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933432 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-methyl-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nc(-c2ccccc2)cc(N(C)C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-10-19-18-20-16(14-7-5-4-6-8-14)12-17(21-18)22(2)15-9-11-25(23,24)13-15/h3-8,12,15H,1,9-11,13H2,2H3,(H,19,20,21) |
| InChIKey | MUGHDJJREOECEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|