C16H20N4O2S — CID 112915649
2-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine (PubChem CID 112915649) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112915649 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCS(=O)(=O)C2)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N4O2S/c1-12-9-15(19-14-7-8-23(21,22)11-14)20-16(18-12)17-10-13-5-3-2-4-6-13/h2-6,9,14H,7-8,10-11H2,1H3,(H2,17,18,19,20) |
| InChIKey | XGDFQRVSLFEUPF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |