C15H18N4O2S — CID 112858744
6-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-4,6-diamine (PubChem CID 112858744) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 6-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112858744 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-N-benzyl-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-4,6-diamine |
| SMILES | O=S1(=O)CCC(Nc2cc(NCc3ccccc3)ncn2)C1 |
| InChI | InChI=1S/C15H18N4O2S/c20-22(21)7-6-13(10-22)19-15-8-14(17-11-18-15)16-9-12-4-2-1-3-5-12/h1-5,8,11,13H,6-7,9-10H2,(H2,16,17,18,19) |
| InChIKey | FBKORYCIVMHJQT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |