C10H15N3O3S — CID 66327551
N-(1,1-dioxothiolan-3-yl)-6-ethoxypyrimidin-4-amine (PubChem CID 66327551) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-ethoxypyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-ethoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 66327551 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-ethoxypyrimidin-4-amine |
| SMILES | CCOc1cc(NC2CCS(=O)(=O)C2)ncn1 |
| InChI | InChI=1S/C10H15N3O3S/c1-2-16-10-5-9(11-7-12-10)13-8-3-4-17(14,15)6-8/h5,7-8H,2-4,6H2,1H3,(H,11,12,13) |
| InChIKey | ZIGGNNNEDYBMBV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |