C12H20N4O3S — CID 112856867
4-N-(1,1-dioxothiolan-3-yl)-6-N-(3-methoxypropyl)pyrimidine-4,6-diamine (PubChem CID 112856867) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-6-N-(3-methoxypropyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-6-N-(3-methoxypropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856867 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-6-N-(3-methoxypropyl)pyrimidine-4,6-diamine |
| SMILES | COCCCNc1cc(NC2CCS(=O)(=O)C2)ncn1 |
| InChI | InChI=1S/C12H20N4O3S/c1-19-5-2-4-13-11-7-12(15-9-14-11)16-10-3-6-20(17,18)8-10/h7,9-10H,2-6,8H2,1H3,(H2,13,14,15,16) |
| InChIKey | LCNYAVFHJFEFKG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|