C12H18N4O3S — CID 109338288
N-(1,1-dioxothiolan-3-yl)-6-(propylamino)pyrimidine-4-carboxamide (PubChem CID 109338288) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-(propylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-(propylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109338288 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-(propylamino)pyrimidine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NC2CCS(=O)(=O)C2)ncn1 |
| InChI | InChI=1S/C12H18N4O3S/c1-2-4-13-11-6-10(14-8-15-11)12(17)16-9-3-5-20(18,19)7-9/h6,8-9H,2-5,7H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | ISEOPVQSTLYRMQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |