C17H20N4O5S — CID 109351869
6-(2,4-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide (PubChem CID 109351869) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 6-(2,4-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-(2,4-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109351869 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 6-(2,4-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NC3CCS(=O)(=O)C3)ncn2)c(OC)c1 |
| InChI | InChI=1S/C17H20N4O5S/c1-25-12-3-4-13(15(7-12)26-2)21-16-8-14(18-10-19-16)17(22)20-11-5-6-27(23,24)9-11/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H,20,22)(H,18,19,21) |
| InChIKey | MLUVUBCOJYESKW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |