C13H20N4O3S — CID 109351812
6-(tert-butylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide (PubChem CID 109351812) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 6-(tert-butylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-(tert-butylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109351812 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 6-(tert-butylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
| SMILES | CC(C)(C)Nc1cc(C(=O)NC2CCS(=O)(=O)C2)ncn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-13(2,3)17-11-6-10(14-8-15-11)12(18)16-9-4-5-21(19,20)7-9/h6,8-9H,4-5,7H2,1-3H3,(H,16,18)(H,14,15,17) |
| InChIKey | GJPFHVURRUCLHC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |