C12H21N5O — CID 94672485
6-N-(2-methoxyethyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine (PubChem CID 94672485) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-methoxyethyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 94672485 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 6-N-(2-methoxyethyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(NC2CCNCC2)ncn1 |
| InChI | InChI=1S/C12H21N5O/c1-18-7-6-14-11-8-12(16-9-15-11)17-10-2-4-13-5-3-10/h8-10,13H,2-7H2,1H3,(H2,14,15,16,17) |
| InChIKey | OBWWXDCEYCJSOV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|