C17H20N4O3S — CID 109327230
N-benzyl-2-[(1,1-dioxothiolan-3-yl)amino]-6-methylpyrimidine-4-carboxamide (PubChem CID 109327230) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-benzyl-2-[(1,1-dioxothiolan-3-yl)amino]-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-benzyl-2-[(1,1-dioxothiolan-3-yl)amino]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109327230 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-benzyl-2-[(1,1-dioxothiolan-3-yl)amino]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccccc2)nc(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C17H20N4O3S/c1-12-9-15(16(22)18-10-13-5-3-2-4-6-13)21-17(19-12)20-14-7-8-25(23,24)11-14/h2-6,9,14H,7-8,10-11H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | LKYIRNRNIDGOOV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |