C20H26N4O2S — CID 112881510
N-(1,1-dioxothiolan-3-yl)-6-(3-methylpiperidin-1-yl)-2-phenylpyrimidin-4-amine (PubChem CID 112881510) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-(3-methylpiperidin-1-yl)-2-phenylpyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-(3-methylpiperidin-1-yl)-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112881510 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-(3-methylpiperidin-1-yl)-2-phenylpyrimidin-4-amine |
| SMILES | CC1CCCN(c2cc(NC3CCS(=O)(=O)C3)nc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C20H26N4O2S/c1-15-6-5-10-24(13-15)19-12-18(21-17-9-11-27(25,26)14-17)22-20(23-19)16-7-3-2-4-8-16/h2-4,7-8,12,15,17H,5-6,9-11,13-14H2,1H3,(H,21,22,23) |
| InChIKey | JBHGZPMOVUJMHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |