C18H24ClN5O2 — CID 118101718
tert-butyl (3R)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 118101718) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118101718 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl (3R)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c(N)cnc3ccc(Cl)nc23)C1 |
| InChI | InChI=1S/C18H24ClN5O2/c1-18(2,3)26-17(25)24-8-4-5-11(10-24)22-15-12(20)9-21-13-6-7-14(19)23-16(13)15/h6-7,9,11H,4-5,8,10,20H2,1-3H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | MCAOERCBQAGPLP-LLVKDONJSA-N |
| XLogP | 3.68 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|