C18H26ClN5O2 — CID 144847195
tert-butyl piperidine-1-carboxylate;6-chloro-1,5-naphthyridine-3,4-diamine (PubChem CID 144847195) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;6-chloro-1,5-naphthyridine-3,4-diamine.
| Compound Name | tert-butyl piperidine-1-carboxylate;6-chloro-1,5-naphthyridine-3,4-diamine |
|---|---|
| PubChem CID | 144847195 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;6-chloro-1,5-naphthyridine-3,4-diamine |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.Nc1cnc2ccc(Cl)nc2c1N |
| InChI | InChI=1S/C10H19NO2.C8H7ClN4/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;9-6-2-1-5-8(13-6)7(11)4(10)3-12-5/h4-8H2,1-3H3;1-3H,10H2,(H2,11,12) |
| InChIKey | PCUNAFCQYXTKIH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|