C14H22ClFN4O2 — CID 153398411
tert-butyl piperidine-1-carboxylate;2-chloro-5-fluoropyrimidin-4-amine (PubChem CID 153398411) has the molecular formula C14H22ClFN4O2 and a molecular weight of 332.81 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;2-chloro-5-fluoropyrimidin-4-amine.
| Compound Name | tert-butyl piperidine-1-carboxylate;2-chloro-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 153398411 |
| Molecular Formula | C14H22ClFN4O2 |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;2-chloro-5-fluoropyrimidin-4-amine |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H19NO2.C4H3ClFN3/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;5-4-8-1-2(6)3(7)9-4/h4-8H2,1-3H3;1H,(H2,7,8,9) |
| InChIKey | QJYPGTRHHPHEBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |