C10H12ClFN2O2S — CID 116687242
tert-butyl 2-(2-chloro-5-fluoropyrimidin-4-yl)sulfanylacetate (PubChem CID 116687242) has the molecular formula C10H12ClFN2O2S and a molecular weight of 278.74 g/mol. Its IUPAC name is tert-butyl 2-(2-chloro-5-fluoropyrimidin-4-yl)sulfanylacetate.
| Compound Name | tert-butyl 2-(2-chloro-5-fluoropyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 116687242 |
| Molecular Formula | C10H12ClFN2O2S |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | tert-butyl 2-(2-chloro-5-fluoropyrimidin-4-yl)sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H12ClFN2O2S/c1-10(2,3)16-7(15)5-17-8-6(12)4-13-9(11)14-8/h4H,5H2,1-3H3 |
| InChIKey | LPNJCIQLEYYNJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |