C11H17N3O3S — CID 116686720
tert-butyl 2-(5-amino-6-methoxypyrimidin-4-yl)sulfanylacetate (PubChem CID 116686720) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is tert-butyl 2-(5-amino-6-methoxypyrimidin-4-yl)sulfanylacetate.
| Compound Name | tert-butyl 2-(5-amino-6-methoxypyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 116686720 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | tert-butyl 2-(5-amino-6-methoxypyrimidin-4-yl)sulfanylacetate |
| SMILES | COc1ncnc(SCC(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C11H17N3O3S/c1-11(2,3)17-7(15)5-18-10-8(12)9(16-4)13-6-14-10/h6H,5,12H2,1-4H3 |
| InChIKey | XHWSIRNVPJOEDQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |