C11H14N4O2S — CID 139632188
tert-butyl 2-(1H-pyrazolo[4,5-d]pyrimidin-7-ylsulfanyl)acetate (PubChem CID 139632188) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is tert-butyl 2-(1H-pyrazolo[4,5-d]pyrimidin-7-ylsulfanyl)acetate.
| Compound Name | tert-butyl 2-(1H-pyrazolo[4,5-d]pyrimidin-7-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 139632188 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | tert-butyl 2-(1H-pyrazolo[4,5-d]pyrimidin-7-ylsulfanyl)acetate |
| SMILES | CC(C)(C)OC(=O)CSc1ncnc2cn[nH]c12 |
| InChI | InChI=1S/C11H14N4O2S/c1-11(2,3)17-8(16)5-18-10-9-7(4-14-15-9)12-6-13-10/h4,6H,5H2,1-3H3,(H,14,15) |
| InChIKey | UFJMXQOCIOSIFI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |