About tert-butyl piperidine-1-carboxylate;pyridin-3-amine
tert-butyl piperidine-1-carboxylate;pyridin-3-amine (PubChem CID 172593579) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;pyridin-3-amine.
Molecular Properties
| Compound Name | tert-butyl piperidine-1-carboxylate;pyridin-3-amine |
| PubChem CID | 172593579 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;pyridin-3-amine |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.Nc1cccnc1 |
| InChI | InChI=1S/C10H19NO2.C5H6N2/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;6-5-2-1-3-7-4-5/h4-8H2,1-3H3;1-4H,6H2 |
| InChIKey | WFGCOXRHHISQHB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl piperidine-1-carboxylate;pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperidine-1-carboxylate;pyridin-3-amine?
The IUPAC name of tert-butyl piperidine-1-carboxylate;pyridin-3-amine (CID 172593579) is tert-butyl piperidine-1-carboxylate;pyridin-3-amine.
What is the SMILES notation for tert-butyl piperidine-1-carboxylate;pyridin-3-amine?
The canonical SMILES for tert-butyl piperidine-1-carboxylate;pyridin-3-amine is CC(C)(C)OC(=O)N1CCCCC1.Nc1cccnc1.
What is the InChIKey of tert-butyl piperidine-1-carboxylate;pyridin-3-amine?
The InChIKey is WFGCOXRHHISQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C5H6N2/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;6-5-2-1-3-7-4-5/h4-8H2,1-3H3;1-4H,6H2.
What are the key properties of tert-butyl piperidine-1-carboxylate;pyridin-3-amine?
tert-butyl piperidine-1-carboxylate;pyridin-3-amine has a molecular weight of 279.38 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperidine-1-carboxylate;pyridin-3-amine is sourced from PubChem (CID 172593579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).