C18H29N3O2 — CID 103982627
tert-butyl 4-[[(1S)-1-pyridin-3-ylethyl]amino]azepane-1-carboxylate (PubChem CID 103982627) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl 4-[[(1S)-1-pyridin-3-ylethyl]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1S)-1-pyridin-3-ylethyl]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 103982627 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl 4-[[(1S)-1-pyridin-3-ylethyl]amino]azepane-1-carboxylate |
| SMILES | C[C@H](NC1CCCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 |
| InChI | InChI=1S/C18H29N3O2/c1-14(15-7-5-10-19-13-15)20-16-8-6-11-21(12-9-16)17(22)23-18(2,3)4/h5,7,10,13-14,16,20H,6,8-9,11-12H2,1-4H3/t14-,16?/m0/s1 |
| InChIKey | KABVOUBJMLCTBE-LBAUFKAWSA-N |
| XLogP | 3.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |