C17H25N3O4 — CID 69321662
tert-butyl 4-[(2-pyridin-3-yloxyacetyl)amino]piperidine-1-carboxylate (PubChem CID 69321662) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl 4-[(2-pyridin-3-yloxyacetyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-pyridin-3-yloxyacetyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69321662 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl 4-[(2-pyridin-3-yloxyacetyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)COc2cccnc2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-17(2,3)24-16(22)20-9-6-13(7-10-20)19-15(21)12-23-14-5-4-8-18-11-14/h4-5,8,11,13H,6-7,9-10,12H2,1-3H3,(H,19,21) |
| InChIKey | NYQIMTFOMUQNSE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |