C34H42FN4O3P — CID 143702973
tert-butyl 4-(4-amino-5-fluoropyrimidin-2-yl)oxypiperidine-1-carboxylate;ethane;triphenylphosphane (PubChem CID 143702973) has the molecular formula C34H42FN4O3P and a molecular weight of 604.71 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-5-fluoropyrimidin-2-yl)oxypiperidine-1-carboxylate;ethane;triphenylphosphane.
| Compound Name | tert-butyl 4-(4-amino-5-fluoropyrimidin-2-yl)oxypiperidine-1-carboxylate;ethane;triphenylphosphane |
|---|---|
| PubChem CID | 143702973 |
| Molecular Formula | C34H42FN4O3P |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | tert-butyl 4-(4-amino-5-fluoropyrimidin-2-yl)oxypiperidine-1-carboxylate;ethane;triphenylphosphane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(Oc2ncc(F)c(N)n2)CC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C14H21FN4O3.C2H6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-14(2,3)22-13(20)19-6-4-9(5-7-19)21-12-17-8-10(15)11(16)18-12;1-2/h1-15H;8-9H,4-7H2,1-3H3,(H2,16,17,18);1-2H3 |
| InChIKey | PDXKCAVDWRWJMS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|