C18H28ClN3O3 — CID 118223893
tert-butyl 3-(6-amino-2-chloro-3-methoxyanilino)azepane-1-carboxylate (PubChem CID 118223893) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is tert-butyl 3-(6-amino-2-chloro-3-methoxyanilino)azepane-1-carboxylate.
| Compound Name | tert-butyl 3-(6-amino-2-chloro-3-methoxyanilino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 118223893 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl 3-(6-amino-2-chloro-3-methoxyanilino)azepane-1-carboxylate |
| SMILES | COc1ccc(N)c(NC2CCCCN(C(=O)OC(C)(C)C)C2)c1Cl |
| InChI | InChI=1S/C18H28ClN3O3/c1-18(2,3)25-17(23)22-10-6-5-7-12(11-22)21-16-13(20)8-9-14(24-4)15(16)19/h8-9,12,21H,5-7,10-11,20H2,1-4H3 |
| InChIKey | QYJNYUFUPKLIEO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|