C19H27ClN4O3 — CID 118224094
tert-butyl 3-(2-amino-7-chloro-6-methoxybenzimidazol-1-yl)azepane-1-carboxylate (PubChem CID 118224094) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-7-chloro-6-methoxybenzimidazol-1-yl)azepane-1-carboxylate.
| Compound Name | tert-butyl 3-(2-amino-7-chloro-6-methoxybenzimidazol-1-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 118224094 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | tert-butyl 3-(2-amino-7-chloro-6-methoxybenzimidazol-1-yl)azepane-1-carboxylate |
| SMILES | COc1ccc2nc(N)n(C3CCCCN(C(=O)OC(C)(C)C)C3)c2c1Cl |
| InChI | InChI=1S/C19H27ClN4O3/c1-19(2,3)27-18(25)23-10-6-5-7-12(11-23)24-16-13(22-17(24)21)8-9-14(26-4)15(16)20/h8-9,12H,5-7,10-11H2,1-4H3,(H2,21,22) |
| InChIKey | PCPJZKJXLHOZAJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |