C19H31N3O3 — CID 118228895
tert-butyl (3R)-3-[2-amino-4-(hydroxymethyl)-6-methylanilino]azepane-1-carboxylate (PubChem CID 118228895) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-amino-4-(hydroxymethyl)-6-methylanilino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-amino-4-(hydroxymethyl)-6-methylanilino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 118228895 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl (3R)-3-[2-amino-4-(hydroxymethyl)-6-methylanilino]azepane-1-carboxylate |
| SMILES | Cc1cc(CO)cc(N)c1N[C@@H]1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H31N3O3/c1-13-9-14(12-23)10-16(20)17(13)21-15-7-5-6-8-22(11-15)18(24)25-19(2,3)4/h9-10,15,21,23H,5-8,11-12,20H2,1-4H3/t15-/m1/s1 |
| InChIKey | OELAFOKXJWZBBZ-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|