C16H27N3O2S — CID 107249463
tert-butyl 3-[(3-aminothiophen-2-yl)methylamino]azepane-1-carboxylate (PubChem CID 107249463) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is tert-butyl 3-[(3-aminothiophen-2-yl)methylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-aminothiophen-2-yl)methylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 107249463 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl 3-[(3-aminothiophen-2-yl)methylamino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC(NCc2sccc2N)C1 |
| InChI | InChI=1S/C16H27N3O2S/c1-16(2,3)21-15(20)19-8-5-4-6-12(11-19)18-10-14-13(17)7-9-22-14/h7,9,12,18H,4-6,8,10-11,17H2,1-3H3 |
| InChIKey | NTOLUAKDQJUSFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |