C15H27N5O2 — CID 103739353
tert-butyl 3-[(3-methyltriazol-4-yl)methylamino]azepane-1-carboxylate (PubChem CID 103739353) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl 3-[(3-methyltriazol-4-yl)methylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-methyltriazol-4-yl)methylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 103739353 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | tert-butyl 3-[(3-methyltriazol-4-yl)methylamino]azepane-1-carboxylate |
| SMILES | Cn1nncc1CNC1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N5O2/c1-15(2,3)22-14(21)20-8-6-5-7-12(11-20)16-9-13-10-17-18-19(13)4/h10,12,16H,5-9,11H2,1-4H3 |
| InChIKey | PNHNCAJBHWDAEF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |