C18H31N3O2 — CID 107241480
tert-butyl 3-[(1-propylpyrrol-2-yl)methylamino]piperidine-1-carboxylate (PubChem CID 107241480) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is tert-butyl 3-[(1-propylpyrrol-2-yl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1-propylpyrrol-2-yl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107241480 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | tert-butyl 3-[(1-propylpyrrol-2-yl)methylamino]piperidine-1-carboxylate |
| SMILES | CCCn1cccc1CNC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H31N3O2/c1-5-10-20-11-7-9-16(20)13-19-15-8-6-12-21(14-15)17(22)23-18(2,3)4/h7,9,11,15,19H,5-6,8,10,12-14H2,1-4H3 |
| InChIKey | IVKOXOXUFJDYBL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |