C18H30N2O2S — CID 107249327
tert-butyl 3-(1-thiophen-2-ylpropylamino)azepane-1-carboxylate (PubChem CID 107249327) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is tert-butyl 3-(1-thiophen-2-ylpropylamino)azepane-1-carboxylate.
| Compound Name | tert-butyl 3-(1-thiophen-2-ylpropylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 107249327 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl 3-(1-thiophen-2-ylpropylamino)azepane-1-carboxylate |
| SMILES | CCC(NC1CCCCN(C(=O)OC(C)(C)C)C1)c1cccs1 |
| InChI | InChI=1S/C18H30N2O2S/c1-5-15(16-10-8-12-23-16)19-14-9-6-7-11-20(13-14)17(21)22-18(2,3)4/h8,10,12,14-15,19H,5-7,9,11,13H2,1-4H3 |
| InChIKey | AHELBEXITPRLRM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |