C17H29N3O2S — CID 103801716
tert-butyl 3-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]pyrrolidine-1-carboxylate (PubChem CID 103801716) has the molecular formula C17H29N3O2S and a molecular weight of 339.50 g/mol. Its IUPAC name is tert-butyl 3-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103801716 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl 3-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C(CNC1CCN(C(=O)OC(C)(C)C)C1)c1cccs1 |
| InChI | InChI=1S/C17H29N3O2S/c1-17(2,3)22-16(21)20-9-8-13(12-20)18-11-14(19(4)5)15-7-6-10-23-15/h6-7,10,13-14,18H,8-9,11-12H2,1-5H3 |
| InChIKey | XDGRNSBXOHOUHL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |