C18H32IN5O2S — CID 111028205
tert-butyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111028205) has the molecular formula C18H32IN5O2S and a molecular weight of 509.46 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111028205 |
| Molecular Formula | C18H32IN5O2S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | tert-butyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CN(C)C(C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)c1cccs1.I |
| InChI | InChI=1S/C18H31N5O2S.HI/c1-18(2,3)25-17(24)23-10-8-22(9-11-23)16(19)20-13-14(21(4)5)15-7-6-12-26-15;/h6-7,12,14H,8-11,13H2,1-5H3,(H2,19,20);1H |
| InChIKey | MJSPPZTXTRREDQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|