C21H35N5O2S — CID 111084469
tert-butyl 4-[N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111084469) has the molecular formula C21H35N5O2S and a molecular weight of 421.61 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111084469 |
| Molecular Formula | C21H35N5O2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | tert-butyl 4-[N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC2CCN(Cc3cccs3)CC2)CC1 |
| InChI | InChI=1S/C21H35N5O2S/c1-21(2,3)28-20(27)26-12-10-25(11-13-26)19(22)23-15-17-6-8-24(9-7-17)16-18-5-4-14-29-18/h4-5,14,17H,6-13,15-16H2,1-3H3,(H2,22,23) |
| InChIKey | FUXGWDJMEDWDQC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|