C24H39N5O3 — CID 111084559
tert-butyl 4-[N'-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111084559) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111084559 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | tert-butyl 4-[N'-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CN2CCC(C/N=C(\N)N3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H39N5O3/c1-24(2,3)32-23(30)29-15-13-28(14-16-29)22(25)26-17-19-9-11-27(12-10-19)18-20-5-7-21(31-4)8-6-20/h5-8,19H,9-18H2,1-4H3,(H2,25,26) |
| InChIKey | KJYTZOADFQIKRE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|