C18H30N4O2S — CID 111820088
tert-butyl 4-[N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111820088) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111820088 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | tert-butyl 4-[N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)Cc1cccs1 |
| InChI | InChI=1S/C18H30N4O2S/c1-14(12-15-6-5-11-25-15)13-20-16(19)21-7-9-22(10-8-21)17(23)24-18(2,3)4/h5-6,11,14H,7-10,12-13H2,1-4H3,(H2,19,20) |
| InChIKey | GJSBUISOHUURCT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|