C16H32N4O3 — CID 111089089
tert-butyl 4-[N'-(2-ethyl-2-hydroxybutyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111089089) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-ethyl-2-hydroxybutyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-(2-ethyl-2-hydroxybutyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111089089 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | tert-butyl 4-[N'-(2-ethyl-2-hydroxybutyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCC(O)(CC)C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N4O3/c1-6-16(22,7-2)12-18-13(17)19-8-10-20(11-9-19)14(21)23-15(3,4)5/h22H,6-12H2,1-5H3,(H2,17,18) |
| InChIKey | GFUODSZKDSGKPX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|