C20H41IN6O2 — CID 111070477
tert-butyl 4-[N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111070477) has the molecular formula C20H41IN6O2 and a molecular weight of 524.49 g/mol. Its IUPAC name is tert-butyl 4-[N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111070477 |
| Molecular Formula | C20H41IN6O2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | tert-butyl 4-[N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN1CCN(CC(C)C/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)CC1.I |
| InChI | InChI=1S/C20H40N6O2.HI/c1-6-23-7-9-24(10-8-23)16-17(2)15-22-18(21)25-11-13-26(14-12-25)19(27)28-20(3,4)5;/h17H,6-16H2,1-5H3,(H2,21,22);1H |
| InChIKey | IDYYFEOJGIRNBM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|