C21H43IN6O2 — CID 109466549
tert-butyl 3-[[N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466549) has the molecular formula C21H43IN6O2 and a molecular weight of 538.52 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466549 |
| Molecular Formula | C21H43IN6O2 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(CC)CC1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H42N6O2.HI/c1-7-22-19(24-18-15-27(16-18)20(28)29-21(4,5)6)23-13-17(3)14-26-11-9-25(8-2)10-12-26;/h17-18H,7-16H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | PCVOUPVKCFMEEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|