C20H36N6O2 — CID 109465998
tert-butyl 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465998) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465998 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | tert-butyl 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(C)Cn1nc(C)cc1C)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H36N6O2/c1-8-21-18(22-10-14(2)11-26-16(4)9-15(3)24-26)23-17-12-25(13-17)19(27)28-20(5,6)7/h9,14,17H,8,10-13H2,1-7H3,(H2,21,22,23) |
| InChIKey | IXIMAGDEOUNFLV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|