C19H34N6O2 — CID 109465996
tert-butyl 3-[[N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465996) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl 3-[[N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465996 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | tert-butyl 3-[[N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCC(C)Cn1nc(C)cc1C)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H34N6O2/c1-13(10-25-15(3)8-14(2)23-25)9-21-17(20-7)22-16-11-24(12-16)18(26)27-19(4,5)6/h8,13,16H,9-12H2,1-7H3,(H2,20,21,22) |
| InChIKey | XXSPSJSMVWFCQW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|