C20H37IN6 — CID 111918238
1-(1-cyclopentylpyrrolidin-3-yl)-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111918238) has the molecular formula C20H37IN6 and a molecular weight of 488.46 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111918238 |
| Molecular Formula | C20H37IN6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)Cn1nc(C)cc1C)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C20H36N6.HI/c1-15(13-26-17(3)11-16(2)24-26)12-22-20(21-4)23-18-9-10-25(14-18)19-7-5-6-8-19;/h11,15,18-19H,5-10,12-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | SWJQCCUMCJZTOH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|