C15H31IN4O3 — CID 110032681
tert-butyl 4-[N'-(2-propan-2-yloxyethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 110032681) has the molecular formula C15H31IN4O3 and a molecular weight of 442.34 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-propan-2-yloxyethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-(2-propan-2-yloxyethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110032681 |
| Molecular Formula | C15H31IN4O3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | tert-butyl 4-[N'-(2-propan-2-yloxyethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)OCC/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C15H30N4O3.HI/c1-12(2)21-11-6-17-13(16)18-7-9-19(10-8-18)14(20)22-15(3,4)5;/h12H,6-11H2,1-5H3,(H2,16,17);1H |
| InChIKey | LIBRPGGGSXKUMH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|