C13H27IN4O4S — CID 111063437
tert-butyl 4-[N'-(2-methylsulfonylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111063437) has the molecular formula C13H27IN4O4S and a molecular weight of 462.35 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-methylsulfonylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-(2-methylsulfonylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111063437 |
| Molecular Formula | C13H27IN4O4S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | tert-butyl 4-[N'-(2-methylsulfonylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CCS(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C13H26N4O4S.HI/c1-13(2,3)21-12(18)17-8-6-16(7-9-17)11(14)15-5-10-22(4,19)20;/h5-10H2,1-4H3,(H2,14,15);1H |
| InChIKey | NPABISBXWRTRHE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|