C18H36N4O3 — CID 111823089
tert-butyl 4-[N'-(3-ethoxy-4-methylpentyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111823089) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl 4-[N'-(3-ethoxy-4-methylpentyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-(3-ethoxy-4-methylpentyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111823089 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | tert-butyl 4-[N'-(3-ethoxy-4-methylpentyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(CC/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)C(C)C |
| InChI | InChI=1S/C18H36N4O3/c1-7-24-15(14(2)3)8-9-20-16(19)21-10-12-22(13-11-21)17(23)25-18(4,5)6/h14-15H,7-13H2,1-6H3,(H2,19,20) |
| InChIKey | LHKCIEZGXVTUOO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|