C18H36IN5O2 — CID 111055140
tert-butyl 4-[N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111055140) has the molecular formula C18H36IN5O2 and a molecular weight of 481.42 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111055140 |
| Molecular Formula | C18H36IN5O2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | tert-butyl 4-[N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCC(C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)N1CCCC1.I |
| InChI | InChI=1S/C18H35N5O2.HI/c1-5-15(21-8-6-7-9-21)14-20-16(19)22-10-12-23(13-11-22)17(24)25-18(2,3)4;/h15H,5-14H2,1-4H3,(H2,19,20);1H |
| InChIKey | YYJQKOQVVAQHTL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|