C17H28N4O3S — CID 111823945
tert-butyl 4-[N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111823945) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111823945 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl 4-[N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC(C)(O)c2ccsc2)CC1 |
| InChI | InChI=1S/C17H28N4O3S/c1-16(2,3)24-15(22)21-8-6-20(7-9-21)14(18)19-12-17(4,23)13-5-10-25-11-13/h5,10-11,23H,6-9,12H2,1-4H3,(H2,18,19) |
| InChIKey | HZGNXGXKWBNBBK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|