C30H42N4O5 — CID 175299081
tert-butyl 3-[2-amino-6-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyanilino]azepane-1-carboxylate (PubChem CID 175299081) has the molecular formula C30H42N4O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-6-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyanilino]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[2-amino-6-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyanilino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 175299081 |
| Molecular Formula | C30H42N4O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | tert-butyl 3-[2-amino-6-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyanilino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC(Nc2c(N)cccc2OC2CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C30H42N4O5/c1-30(2,3)39-29(36)34-17-8-7-12-23(20-34)32-27-25(31)13-9-14-26(27)38-24-15-18-33(19-16-24)28(35)37-21-22-10-5-4-6-11-22/h4-6,9-11,13-14,23-24,32H,7-8,12,15-21,31H2,1-3H3 |
| InChIKey | GHLJFWNMGYLADS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|