C23H31N3O2S — CID 155248580
tert-butyl 4-(2-amino-6-benzylsulfanylanilino)piperidine-1-carboxylate (PubChem CID 155248580) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-6-benzylsulfanylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-6-benzylsulfanylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155248580 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl 4-(2-amino-6-benzylsulfanylanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2c(N)cccc2SCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O2S/c1-23(2,3)28-22(27)26-14-12-18(13-15-26)25-21-19(24)10-7-11-20(21)29-16-17-8-5-4-6-9-17/h4-11,18,25H,12-16,24H2,1-3H3 |
| InChIKey | CSMINEMHIMAUOS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|