C18H27NO3S — CID 126847748
tert-butyl 4-(benzylsulfanylmethyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 126847748) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl 4-(benzylsulfanylmethyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(benzylsulfanylmethyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126847748 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl 4-(benzylsulfanylmethyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CSCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO3S/c1-17(2,3)22-16(20)19-11-9-18(21,10-12-19)14-23-13-15-7-5-4-6-8-15/h4-8,21H,9-14H2,1-3H3 |
| InChIKey | QAAXAZOXFFXBJH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |