C19H29NO5S — CID 171480544
tert-butyl 4-(2-benzylsulfonylethyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 171480544) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl 4-(2-benzylsulfonylethyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-benzylsulfonylethyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171480544 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl 4-(2-benzylsulfonylethyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CCS(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29NO5S/c1-18(2,3)25-17(21)20-12-9-19(22,10-13-20)11-14-26(23,24)15-16-7-5-4-6-8-16/h4-8,22H,9-15H2,1-3H3 |
| InChIKey | PDMNFUZUHOJDJW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |